C29H44N4O5 — CID 67493732
(2S)-4-acetyl-N-[(2R,3S)-1-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-2-hydroxyhex-5-en-3-yl]morpholine-2-carboxamide (PubChem CID 67493732) has the molecular formula C29H44N4O5 and a molecular weight of 528.69 g/mol. Its IUPAC name is (2S)-4-acetyl-N-[(2R,3S)-1-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-2-hydroxyhex-5-en-3-yl]morpholine-2-carboxamide.
| Compound Name | (2S)-4-acetyl-N-[(2R,3S)-1-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-2-hydroxyhex-5-en-3-yl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 67493732 |
| Molecular Formula | C29H44N4O5 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | (2S)-4-acetyl-N-[(2R,3S)-1-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-2-hydroxyhex-5-en-3-yl]morpholine-2-carboxamide |
| SMILES | C=CC[C@H](NC(=O)[C@@H]1CN(C(C)=O)CCO1)[C@H](O)CN[C@H]1CC2(CCC2)Oc2ncc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C29H44N4O5/c1-6-8-22(32-26(36)25-18-33(19(2)34)11-12-37-25)24(35)17-30-23-15-29(9-7-10-29)38-27-21(23)13-20(16-31-27)14-28(3,4)5/h6,13,16,22-25,30,35H,1,7-12,14-15,17-18H2,2-5H3,(H,32,36)/t22-,23-,24+,25-/m0/s1 |
| InChIKey | FGLRUCNZVRYVNH-JBXUNAHCSA-N |
| XLogP | 2.68 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|