C31H42N4O5 — CID 89438885
N-[(2R,3S)-1-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-2-hydroxyhex-5-en-3-yl]-2-pyridin-3-yl-1,3-dioxolane-4-carboxamide (PubChem CID 89438885) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is N-[(2R,3S)-1-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-2-hydroxyhex-5-en-3-yl]-2-pyridin-3-yl-1,3-dioxolane-4-carboxamide.
| Compound Name | N-[(2R,3S)-1-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-2-hydroxyhex-5-en-3-yl]-2-pyridin-3-yl-1,3-dioxolane-4-carboxamide |
|---|---|
| PubChem CID | 89438885 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | N-[(2R,3S)-1-[[(4S)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-2-hydroxyhex-5-en-3-yl]-2-pyridin-3-yl-1,3-dioxolane-4-carboxamide |
| SMILES | C=CC[C@H](NC(=O)C1COC(c2cccnc2)O1)[C@H](O)CN[C@H]1CC2(CCC2)Oc2ncc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C31H42N4O5/c1-5-8-23(35-27(37)26-19-38-29(39-26)21-9-6-12-32-17-21)25(36)18-33-24-15-31(10-7-11-31)40-28-22(24)13-20(16-34-28)14-30(2,3)4/h5-6,9,12-13,16-17,23-26,29,33,36H,1,7-8,10-11,14-15,18-19H2,2-4H3,(H,35,37)/t23-,24-,25+,26?,29?/m0/s1 |
| InChIKey | UTAPEVJZJVFALW-AYKZCTJPSA-N |
| XLogP | 3.94 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|