C12H11N5OS — CID 25169486
6-(3-methoxyanilino)-1,7-dihydropurine-2-thione (PubChem CID 25169486) has the molecular formula C12H11N5OS and a molecular weight of 273.32 g/mol. Its IUPAC name is 6-(3-methoxyanilino)-1,7-dihydropurine-2-thione.
| Compound Name | 6-(3-methoxyanilino)-1,7-dihydropurine-2-thione |
|---|---|
| PubChem CID | 25169486 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 6-(3-methoxyanilino)-1,7-dihydropurine-2-thione |
| SMILES | COc1cccc(Nc2[nH]c(=S)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C12H11N5OS/c1-18-8-4-2-3-7(5-8)15-11-9-10(14-6-13-9)16-12(19)17-11/h2-6H,1H3,(H3,13,14,15,16,17,19) |
| InChIKey | ZWRHIFVOGHTHBY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|