C17H15N7O — CID 108778059
N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-7H-purin-6-amine (PubChem CID 108778059) has the molecular formula C17H15N7O and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-7H-purin-6-amine.
| Compound Name | N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 108778059 |
| Molecular Formula | C17H15N7O |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[3-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-7H-purin-6-amine |
| SMILES | Cc1cc(C)nc(Oc2cccc(Nc3ncnc4nc[nH]c34)c2)n1 |
| InChI | InChI=1S/C17H15N7O/c1-10-6-11(2)23-17(22-10)25-13-5-3-4-12(7-13)24-16-14-15(19-8-18-14)20-9-21-16/h3-9H,1-2H3,(H2,18,19,20,21,24) |
| InChIKey | ULMKQAPGRKPDNE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |