C14H28N2O4S — CID 25169724
(2R)-N-[4-(2-ethylsulfanylethylamino)-4-oxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 25169724) has the molecular formula C14H28N2O4S and a molecular weight of 320.46 g/mol. Its IUPAC name is (2R)-N-[4-(2-ethylsulfanylethylamino)-4-oxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-[4-(2-ethylsulfanylethylamino)-4-oxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 25169724 |
| Molecular Formula | C14H28N2O4S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2R)-N-[4-(2-ethylsulfanylethylamino)-4-oxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CCSCCNC(=O)CCCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C14H28N2O4S/c1-4-21-9-8-15-11(18)6-5-7-16-13(20)12(19)14(2,3)10-17/h12,17,19H,4-10H2,1-3H3,(H,15,18)(H,16,20)/t12-/m0/s1 |
| InChIKey | PFNSVPQVCXAVJC-LBPRGKRZSA-N |
| XLogP | 0.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|