C22H28ClN5OS — CID 25170800
N-[5-tert-butyl-3-[[(2R)-piperidin-2-yl]methyl]-1,3-thiazol-2-ylidene]-5-chloro-N'-cyano-2-methoxybenzenecarboximidamide (PubChem CID 25170800) has the molecular formula C22H28ClN5OS and a molecular weight of 446.02 g/mol. Its IUPAC name is N-[5-tert-butyl-3-[[(2R)-piperidin-2-yl]methyl]-1,3-thiazol-2-ylidene]-5-chloro-N'-cyano-2-methoxybenzenecarboximidamide.
| Compound Name | N-[5-tert-butyl-3-[[(2R)-piperidin-2-yl]methyl]-1,3-thiazol-2-ylidene]-5-chloro-N'-cyano-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 25170800 |
| Molecular Formula | C22H28ClN5OS |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[5-tert-butyl-3-[[(2R)-piperidin-2-yl]methyl]-1,3-thiazol-2-ylidene]-5-chloro-N'-cyano-2-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(Cl)cc1C(=N\C#N)/N=c1/sc(C(C)(C)C)cn1C[C@H]1CCCCN1 |
| InChI | InChI=1S/C22H28ClN5OS/c1-22(2,3)19-13-28(12-16-7-5-6-10-25-16)21(30-19)27-20(26-14-24)17-11-15(23)8-9-18(17)29-4/h8-9,11,13,16,25H,5-7,10,12H2,1-4H3/b26-20+,27-21+/t16-/m1/s1 |
| InChIKey | KLUKVXCONFWLPO-BQGOUEMOSA-N |
| XLogP | 4.48 |
| TPSA | 74.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|