C17H16Cl2N4OS — CID 25170803
5-chloro-N-[5-chloro-3-(cyclobutylmethyl)-1,3-thiazol-2-ylidene]-N'-cyano-2-methoxybenzenecarboximidamide (PubChem CID 25170803) has the molecular formula C17H16Cl2N4OS and a molecular weight of 395.32 g/mol. Its IUPAC name is 5-chloro-N-[5-chloro-3-(cyclobutylmethyl)-1,3-thiazol-2-ylidene]-N'-cyano-2-methoxybenzenecarboximidamide.
| Compound Name | 5-chloro-N-[5-chloro-3-(cyclobutylmethyl)-1,3-thiazol-2-ylidene]-N'-cyano-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 25170803 |
| Molecular Formula | C17H16Cl2N4OS |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 5-chloro-N-[5-chloro-3-(cyclobutylmethyl)-1,3-thiazol-2-ylidene]-N'-cyano-2-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(Cl)cc1C(=N/C#N)/N=c1\sc(Cl)cn1CC1CCC1 |
| InChI | InChI=1S/C17H16Cl2N4OS/c1-24-14-6-5-12(18)7-13(14)16(21-10-20)22-17-23(9-15(19)25-17)8-11-3-2-4-11/h5-7,9,11H,2-4,8H2,1H3/b21-16-,22-17- |
| InChIKey | WLRYLVUECYLKJA-QLBLWQCWSA-N |
| XLogP | 4.49 |
| TPSA | 62.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|