C21H26ClN5O3S2 — CID 25170023
N-[5-tert-butyl-3-[(1-methylsulfonylazetidin-3-yl)methyl]-1,3-thiazol-2-ylidene]-5-chloro-N'-cyano-2-methoxybenzenecarboximidamide (PubChem CID 25170023) has the molecular formula C21H26ClN5O3S2 and a molecular weight of 496.06 g/mol. Its IUPAC name is N-[5-tert-butyl-3-[(1-methylsulfonylazetidin-3-yl)methyl]-1,3-thiazol-2-ylidene]-5-chloro-N'-cyano-2-methoxybenzenecarboximidamide.
| Compound Name | N-[5-tert-butyl-3-[(1-methylsulfonylazetidin-3-yl)methyl]-1,3-thiazol-2-ylidene]-5-chloro-N'-cyano-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 25170023 |
| Molecular Formula | C21H26ClN5O3S2 |
| Molecular Weight | 496.06 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | N-[5-tert-butyl-3-[(1-methylsulfonylazetidin-3-yl)methyl]-1,3-thiazol-2-ylidene]-5-chloro-N'-cyano-2-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(Cl)cc1C(=N\C#N)/N=c1/sc(C(C)(C)C)cn1CC1CN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C21H26ClN5O3S2/c1-21(2,3)18-12-26(9-14-10-27(11-14)32(5,28)29)20(31-18)25-19(24-13-23)16-8-15(22)6-7-17(16)30-4/h6-8,12,14H,9-11H2,1-5H3/b24-19+,25-20+ |
| InChIKey | YTHZKKQVNNQLOY-WJFDJXNHSA-N |
| XLogP | 3.23 |
| TPSA | 100.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.06 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|