C21H25ClN4O2S — CID 87179476
5-chloro-N'-cyano-N-[4,4-dimethyl-1-(2-methylpropyl)-6,7-dihydropyrano[4,3-d][1,3]thiazol-2-ylidene]-2-methoxybenzenecarboximidamide (PubChem CID 87179476) has the molecular formula C21H25ClN4O2S and a molecular weight of 432.98 g/mol. Its IUPAC name is 5-chloro-N'-cyano-N-[4,4-dimethyl-1-(2-methylpropyl)-6,7-dihydropyrano[4,3-d][1,3]thiazol-2-ylidene]-2-methoxybenzenecarboximidamide.
| Compound Name | 5-chloro-N'-cyano-N-[4,4-dimethyl-1-(2-methylpropyl)-6,7-dihydropyrano[4,3-d][1,3]thiazol-2-ylidene]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 87179476 |
| Molecular Formula | C21H25ClN4O2S |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-chloro-N'-cyano-N-[4,4-dimethyl-1-(2-methylpropyl)-6,7-dihydropyrano[4,3-d][1,3]thiazol-2-ylidene]-2-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(Cl)cc1C(/N=c1\sc2c(n1CC(C)C)CCOC2(C)C)=N\C#N |
| InChI | InChI=1S/C21H25ClN4O2S/c1-13(2)11-26-16-8-9-28-21(3,4)18(16)29-20(26)25-19(24-12-23)15-10-14(22)6-7-17(15)27-5/h6-7,10,13H,8-9,11H2,1-5H3/b24-19+,25-20- |
| InChIKey | SFSVVEPSSGHJLV-RNDVANFQSA-N |
| XLogP | 4.50 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|