C19H25BrN2O5 — CID 25170853
methyl (Z)-3-bromo-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]but-2-enoate (PubChem CID 25170853) has the molecular formula C19H25BrN2O5 and a molecular weight of 441.32 g/mol. Its IUPAC name is methyl (Z)-3-bromo-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]but-2-enoate.
| Compound Name | methyl (Z)-3-bromo-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 25170853 |
| Molecular Formula | C19H25BrN2O5 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | methyl (Z)-3-bromo-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]but-2-enoate |
| SMILES | COC(=O)/C(NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)=C(\C)Br |
| InChI | InChI=1S/C19H25BrN2O5/c1-12(20)15(17(24)26-5)22-16(23)14(11-13-9-7-6-8-10-13)21-18(25)27-19(2,3)4/h6-10,14H,11H2,1-5H3,(H,21,25)(H,22,23)/b15-12-/t14-/m0/s1 |
| InChIKey | PHXGYTDSYMZQKE-UZFBZYOGSA-N |
| XLogP | 3.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|