C18H16FN3O2S — CID 25172125
4-[2-(4-fluorophenyl)ethynyl]-2-methylsulfanyl-6-morpholin-4-ylpyrimidine-5-carbaldehyde (PubChem CID 25172125) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethynyl]-2-methylsulfanyl-6-morpholin-4-ylpyrimidine-5-carbaldehyde.
| Compound Name | 4-[2-(4-fluorophenyl)ethynyl]-2-methylsulfanyl-6-morpholin-4-ylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 25172125 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethynyl]-2-methylsulfanyl-6-morpholin-4-ylpyrimidine-5-carbaldehyde |
| SMILES | CSc1nc(C#Cc2ccc(F)cc2)c(C=O)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-25-18-20-16(7-4-13-2-5-14(19)6-3-13)15(12-23)17(21-18)22-8-10-24-11-9-22/h2-3,5-6,12H,8-11H2,1H3 |
| InChIKey | PJBVYPYMEAQBKW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|