C24H19F3N4O2 — CID 102417261
2-morpholin-4-yl-4-(2-phenylethynyl)-6-[3-(trifluoromethyl)anilino]pyrimidine-5-carbaldehyde (PubChem CID 102417261) has the molecular formula C24H19F3N4O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is 2-morpholin-4-yl-4-(2-phenylethynyl)-6-[3-(trifluoromethyl)anilino]pyrimidine-5-carbaldehyde.
| Compound Name | 2-morpholin-4-yl-4-(2-phenylethynyl)-6-[3-(trifluoromethyl)anilino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 102417261 |
| Molecular Formula | C24H19F3N4O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-morpholin-4-yl-4-(2-phenylethynyl)-6-[3-(trifluoromethyl)anilino]pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1c(C#Cc2ccccc2)nc(N2CCOCC2)nc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H19F3N4O2/c25-24(26,27)18-7-4-8-19(15-18)28-22-20(16-32)21(10-9-17-5-2-1-3-6-17)29-23(30-22)31-11-13-33-14-12-31/h1-8,15-16H,11-14H2,(H,28,29,30) |
| InChIKey | QVCMBNFVIPKHJS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|