C14H22O5 — CID 25172138
dimethyl (3aS,4S,7R,8R,8aS)-8-hydroxy-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-4,7-dicarboxylate (PubChem CID 25172138) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is dimethyl (3aS,4S,7R,8R,8aS)-8-hydroxy-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-4,7-dicarboxylate.
| Compound Name | dimethyl (3aS,4S,7R,8R,8aS)-8-hydroxy-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-4,7-dicarboxylate |
|---|---|
| PubChem CID | 25172138 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | dimethyl (3aS,4S,7R,8R,8aS)-8-hydroxy-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-4,7-dicarboxylate |
| SMILES | COC(=O)[C@H]1CC[C@@H](C(=O)OC)[C@H](O)[C@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C14H22O5/c1-18-13(16)10-6-7-11(14(17)19-2)12(15)9-5-3-4-8(9)10/h8-12,15H,3-7H2,1-2H3/t8-,9-,10-,11+,12+/m0/s1 |
| InChIKey | BTHGFXJWUNEDES-KKJSVHSVSA-N |
| XLogP | 1.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |