C23H23N3O3 — CID 25172718
1,3-dimethyl-2,6-dioxo-5-spiro[6H-phenanthridin-5-ium-5,1'-azolidin-1-ium]-6-ylpyrimidin-4-olate (PubChem CID 25172718) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1,3-dimethyl-2,6-dioxo-5-spiro[6H-phenanthridin-5-ium-5,1'-azolidin-1-ium]-6-ylpyrimidin-4-olate.
| Compound Name | 1,3-dimethyl-2,6-dioxo-5-spiro[6H-phenanthridin-5-ium-5,1'-azolidin-1-ium]-6-ylpyrimidin-4-olate |
|---|---|
| PubChem CID | 25172718 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1,3-dimethyl-2,6-dioxo-5-spiro[6H-phenanthridin-5-ium-5,1'-azolidin-1-ium]-6-ylpyrimidin-4-olate |
| SMILES | Cn1c([O-])c(C2c3ccccc3-c3ccccc3[N+]23CCCC3)c(=O)n(C)c1=O |
| InChI | InChI=1S/C23H23N3O3/c1-24-21(27)19(22(28)25(2)23(24)29)20-17-11-4-3-9-15(17)16-10-5-6-12-18(16)26(20)13-7-8-14-26/h3-6,9-12,20H,7-8,13-14H2,1-2H3 |
| InChIKey | HKVQJNNKMWPBTE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|