C16H14N2O2 — CID 12034984
13,15-dimethyl-13,15-diazatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,11(16)-pentaene-12,14-dione (PubChem CID 12034984) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 13,15-dimethyl-13,15-diazatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,11(16)-pentaene-12,14-dione.
| Compound Name | 13,15-dimethyl-13,15-diazatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,11(16)-pentaene-12,14-dione |
|---|---|
| PubChem CID | 12034984 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 13,15-dimethyl-13,15-diazatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6,8,11(16)-pentaene-12,14-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C1C=Cc3ccccc3C21 |
| InChI | InChI=1S/C16H14N2O2/c1-17-14-12-10-6-4-3-5-9(10)7-8-11(12)13(14)15(19)18(2)16(17)20/h3-8,11-12H,1-2H3 |
| InChIKey | UAGMGBKUFUHZNQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |