C23H27NO3 — CID 139190110
2-[(6S)-5,5-dimethyl-6H-phenanthridin-5-ium-6-yl]-5,5-dimethyl-3-oxocyclohexen-1-olate;hydrate (PubChem CID 139190110) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 2-[(6S)-5,5-dimethyl-6H-phenanthridin-5-ium-6-yl]-5,5-dimethyl-3-oxocyclohexen-1-olate;hydrate.
| Compound Name | 2-[(6S)-5,5-dimethyl-6H-phenanthridin-5-ium-6-yl]-5,5-dimethyl-3-oxocyclohexen-1-olate;hydrate |
|---|---|
| PubChem CID | 139190110 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-[(6S)-5,5-dimethyl-6H-phenanthridin-5-ium-6-yl]-5,5-dimethyl-3-oxocyclohexen-1-olate;hydrate |
| SMILES | CC1(C)CC(=O)C([C@@H]2c3ccccc3-c3ccccc3[N+]2(C)C)=C([O-])C1.O |
| InChI | InChI=1S/C23H25NO2.H2O/c1-23(2)13-19(25)21(20(26)14-23)22-17-11-6-5-9-15(17)16-10-7-8-12-18(16)24(22,3)4;/h5-12,22H,13-14H2,1-4H3;1H2/t22-;/m0./s1 |
| InChIKey | RSRJEDZIEDHMRZ-FTBISJDPSA-N |
| XLogP | 3.15 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|