C25H23NO2 — CID 102455669
2-[(2S)-1,1-dimethyl-2H-benzo[cd]indol-1-ium-2-yl]-3-oxo-5-phenylcyclohexen-1-olate (PubChem CID 102455669) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[(2S)-1,1-dimethyl-2H-benzo[cd]indol-1-ium-2-yl]-3-oxo-5-phenylcyclohexen-1-olate.
| Compound Name | 2-[(2S)-1,1-dimethyl-2H-benzo[cd]indol-1-ium-2-yl]-3-oxo-5-phenylcyclohexen-1-olate |
|---|---|
| PubChem CID | 102455669 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[(2S)-1,1-dimethyl-2H-benzo[cd]indol-1-ium-2-yl]-3-oxo-5-phenylcyclohexen-1-olate |
| SMILES | C[N+]1(C)c2cccc3cccc(c23)[C@H]1C1=C([O-])CC(c2ccccc2)CC1=O |
| InChI | InChI=1S/C25H23NO2/c1-26(2)20-13-7-11-17-10-6-12-19(23(17)20)25(26)24-21(27)14-18(15-22(24)28)16-8-4-3-5-9-16/h3-13,18,25H,14-15H2,1-2H3/t25-/m0/s1 |
| InChIKey | YUJQVDUYWMGSDX-VWLOTQADSA-N |
| XLogP | 4.22 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|