About 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea
1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea (PubChem CID 25176099) has the molecular formula C20H22N8O
and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea |
| PubChem CID | 25176099 |
| Molecular Formula | C20H22N8O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea |
| SMILES | CC(C)n1nnc(CCNC(=O)Nc2cn3cc(-c4ccccc4)ccc3n2)n1 |
| InChI | InChI=1S/C20H22N8O/c1-14(2)28-25-17(24-26-28)10-11-21-20(29)23-18-13-27-12-16(8-9-19(27)22-18)15-6-4-3-5-7-15/h3-9,12-14H,10-11H2,1-2H3,(H2,21,23,29) |
| InChIKey | FGLMXKAMKKVJIG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea?
The IUPAC name of 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea (CID 25176099) is 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea.
What is the SMILES notation for 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea?
The canonical SMILES for 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea is CC(C)n1nnc(CCNC(=O)Nc2cn3cc(-c4ccccc4)ccc3n2)n1.
What is the InChIKey of 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea?
The InChIKey is FGLMXKAMKKVJIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N8O/c1-14(2)28-25-17(24-26-28)10-11-21-20(29)23-18-13-27-12-16(8-9-19(27)22-18)15-6-4-3-5-7-15/h3-9,12-14H,10-11H2,1-2H3,(H2,21,23,29).
What are the key properties of 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea?
1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea has a molecular weight of 390.45 g/mol, XLogP of 2.93, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-phenylimidazo[1,2-a]pyridin-2-yl)-3-[2-(2-propan-2-yltetrazol-5-yl)ethyl]urea is sourced from PubChem (CID 25176099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).