C18H23IN4O8 — CID 25178941
(2S)-2-[[(1S)-1-carboxy-5-[(5-iodopyridine-3-carbonyl)amino]pentyl]carbamoylamino]pentanedioic acid (PubChem CID 25178941) has the molecular formula C18H23IN4O8 and a molecular weight of 550.31 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[(5-iodopyridine-3-carbonyl)amino]pentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[(5-iodopyridine-3-carbonyl)amino]pentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 25178941 |
| Molecular Formula | C18H23IN4O8 |
| Molecular Weight | 550.31 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[(5-iodopyridine-3-carbonyl)amino]pentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)c1cncc(I)c1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H23IN4O8/c19-11-7-10(8-20-9-11)15(26)21-6-2-1-3-12(16(27)28)22-18(31)23-13(17(29)30)4-5-14(24)25/h7-9,12-13H,1-6H2,(H,21,26)(H,24,25)(H,27,28)(H,29,30)(H2,22,23,31)/t12-,13-/m0/s1 |
| InChIKey | UMTBXFVMGMLOHV-STQMWFEESA-N |
| XLogP | 0.66 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|