C27H34N4O4 — CID 25178961
(2S)-1-N-[[4-(5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-2-methylphenyl]methyl]-2-N,2-N-dimethylpyrrolidine-1,2-dicarboxamide (PubChem CID 25178961) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is (2S)-1-N-[[4-(5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-2-methylphenyl]methyl]-2-N,2-N-dimethylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-[[4-(5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-2-methylphenyl]methyl]-2-N,2-N-dimethylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 25178961 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (2S)-1-N-[[4-(5-hydroxy-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-2-methylphenyl]methyl]-2-N,2-N-dimethylpyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1cc(C(=O)N2CCCC(O)c3ccccc32)ccc1CNC(=O)N1CCC[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C27H34N4O4/c1-18-16-19(25(33)30-14-7-11-24(32)21-8-4-5-9-22(21)30)12-13-20(18)17-28-27(35)31-15-6-10-23(31)26(34)29(2)3/h4-5,8-9,12-13,16,23-24,32H,6-7,10-11,14-15,17H2,1-3H3,(H,28,35)/t23-,24?/m0/s1 |
| InChIKey | DGZMHKYASBSTTP-UXMRNZNESA-N |
| XLogP | 3.23 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |