C15H27IO3Si — CID 25179745
(3aS,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6a-(iodomethyl)-3a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 25179745) has the molecular formula C15H27IO3Si and a molecular weight of 410.37 g/mol. Its IUPAC name is (3aS,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6a-(iodomethyl)-3a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6a-(iodomethyl)-3a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 25179745 |
| Molecular Formula | C15H27IO3Si |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (3aS,5R,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6a-(iodomethyl)-3a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@]2(C)CC(=O)O[C@@]2(CI)C1 |
| InChI | InChI=1S/C15H27IO3Si/c1-13(2,3)20(5,6)19-11-7-14(4)9-12(17)18-15(14,8-11)10-16/h11H,7-10H2,1-6H3/t11-,14+,15-/m1/s1 |
| InChIKey | ITEMYYXVVSICQP-BYCMXARLSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|