C18H29IO5Si — CID 89187016
(1R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione (PubChem CID 89187016) has the molecular formula C18H29IO5Si and a molecular weight of 480.42 g/mol. Its IUPAC name is (1R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione.
| Compound Name | (1R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione |
|---|---|
| PubChem CID | 89187016 |
| Molecular Formula | C18H29IO5Si |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (1R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1C2CC(=O)OC2(CI)[C@@]2(C)COC(=O)[C@@]12C |
| InChI | InChI=1S/C18H29IO5Si/c1-15(2,3)25(6,7)24-13-11-8-12(20)23-18(11,9-19)16(4)10-22-14(21)17(13,16)5/h11,13H,8-10H2,1-7H3/t11?,13?,16-,17+,18?/m0/s1 |
| InChIKey | HOOJTLZEINRMHL-HHBUGSCRSA-N |
| XLogP | 3.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|