C21H34O6Si — CID 102489801
(1S,2S,6S,7S,8R,14R)-7-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione (PubChem CID 102489801) has the molecular formula C21H34O6Si and a molecular weight of 410.58 g/mol. Its IUPAC name is (1S,2S,6S,7S,8R,14R)-7-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione.
| Compound Name | (1S,2S,6S,7S,8R,14R)-7-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
|---|---|
| PubChem CID | 102489801 |
| Molecular Formula | C21H34O6Si |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (1S,2S,6S,7S,8R,14R)-7-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-2,6,14-trimethyl-4,11-dioxatetracyclo[6.3.3.01,8.02,6]tetradecane-5,10-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@]23CC(=O)O[C@@]2(CC[C@@]3(C)O)[C@]2(C)COC(=O)[C@]12C |
| InChI | InChI=1S/C21H34O6Si/c1-16(2,3)28(7,8)27-14-19(6)15(23)25-12-17(19,4)21-10-9-18(5,24)20(14,21)11-13(22)26-21/h14,24H,9-12H2,1-8H3/t14-,17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | SFEAQWXHNQOYAI-RJGLBQMWSA-N |
| XLogP | 3.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|