C13H17IO4 — CID 58681987
(1S,2R,6R,7R,8R)-2-(iodomethyl)-1,7,8-trimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione (PubChem CID 58681987) has the molecular formula C13H17IO4 and a molecular weight of 364.18 g/mol. Its IUPAC name is (1S,2R,6R,7R,8R)-2-(iodomethyl)-1,7,8-trimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione.
| Compound Name | (1S,2R,6R,7R,8R)-2-(iodomethyl)-1,7,8-trimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione |
|---|---|
| PubChem CID | 58681987 |
| Molecular Formula | C13H17IO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (1S,2R,6R,7R,8R)-2-(iodomethyl)-1,7,8-trimethyl-3,10-dioxatricyclo[6.3.0.02,6]undecane-4,9-dione |
| SMILES | C[C@@H]1[C@H]2CC(=O)O[C@@]2(CI)[C@]2(C)COC(=O)[C@]12C |
| InChI | InChI=1S/C13H17IO4/c1-7-8-4-9(15)18-13(8,5-14)11(2)6-17-10(16)12(7,11)3/h7-8H,4-6H2,1-3H3/t7-,8-,11-,12+,13-/m1/s1 |
| InChIKey | WOBDKNZUZMSHJT-JVRMSLSOSA-N |
| XLogP | 1.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|