C24H23ClN4O4S — CID 25182495
(3Z)-3-[(2-butyl-5-chloro-4-formylimidazol-1-yl)methylidene]-N-(3-methylphenyl)-2-oxo-1H-indole-5-sulfonamide (PubChem CID 25182495) has the molecular formula C24H23ClN4O4S and a molecular weight of 498.99 g/mol. Its IUPAC name is (3Z)-3-[(2-butyl-5-chloro-4-formylimidazol-1-yl)methylidene]-N-(3-methylphenyl)-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | (3Z)-3-[(2-butyl-5-chloro-4-formylimidazol-1-yl)methylidene]-N-(3-methylphenyl)-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 25182495 |
| Molecular Formula | C24H23ClN4O4S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | (3Z)-3-[(2-butyl-5-chloro-4-formylimidazol-1-yl)methylidene]-N-(3-methylphenyl)-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CCCCc1nc(C=O)c(Cl)n1/C=C1\C(=O)Nc2ccc(S(=O)(=O)Nc3cccc(C)c3)cc21 |
| InChI | InChI=1S/C24H23ClN4O4S/c1-3-4-8-22-26-21(14-30)23(25)29(22)13-19-18-12-17(9-10-20(18)27-24(19)31)34(32,33)28-16-7-5-6-15(2)11-16/h5-7,9-14,28H,3-4,8H2,1-2H3,(H,27,31)/b19-13- |
| InChIKey | BIPHRNKQMALVGN-UYRXBGFRSA-N |
| XLogP | 4.75 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|