C14H18O11 — CID 25185157
[(3S,3aS,4R,5R,7S,7aR)-4,7-diacetyloxy-3,3a-dihydroxy-2-oxo-4,5,7,7a-tetrahydro-3H-furo[2,3-c]pyran-5-yl]methyl acetate (PubChem CID 25185157) has the molecular formula C14H18O11 and a molecular weight of 362.29 g/mol. Its IUPAC name is [(3S,3aS,4R,5R,7S,7aR)-4,7-diacetyloxy-3,3a-dihydroxy-2-oxo-4,5,7,7a-tetrahydro-3H-furo[2,3-c]pyran-5-yl]methyl acetate.
| Compound Name | [(3S,3aS,4R,5R,7S,7aR)-4,7-diacetyloxy-3,3a-dihydroxy-2-oxo-4,5,7,7a-tetrahydro-3H-furo[2,3-c]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 25185157 |
| Molecular Formula | C14H18O11 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [(3S,3aS,4R,5R,7S,7aR)-4,7-diacetyloxy-3,3a-dihydroxy-2-oxo-4,5,7,7a-tetrahydro-3H-furo[2,3-c]pyran-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@@H]2OC(=O)[C@@H](O)[C@]2(O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H18O11/c1-5(15)21-4-8-10(22-6(2)16)14(20)9(18)12(19)25-11(14)13(24-8)23-7(3)17/h8-11,13,18,20H,4H2,1-3H3/t8-,9-,10-,11+,13-,14+/m1/s1 |
| InChIKey | WMKKOTHWPWOIJB-LZLVENHBSA-N |
| XLogP | -2.21 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|