C23H24F3NO3S — CID 25185804
(2S)-5-oxo-2-phenyl-2-[4-(trifluoromethyl)phenyl]sulfonyldecanenitrile (PubChem CID 25185804) has the molecular formula C23H24F3NO3S and a molecular weight of 451.51 g/mol. Its IUPAC name is (2S)-5-oxo-2-phenyl-2-[4-(trifluoromethyl)phenyl]sulfonyldecanenitrile.
| Compound Name | (2S)-5-oxo-2-phenyl-2-[4-(trifluoromethyl)phenyl]sulfonyldecanenitrile |
|---|---|
| PubChem CID | 25185804 |
| Molecular Formula | C23H24F3NO3S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (2S)-5-oxo-2-phenyl-2-[4-(trifluoromethyl)phenyl]sulfonyldecanenitrile |
| SMILES | CCCCCC(=O)CC[C@@](C#N)(c1ccccc1)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H24F3NO3S/c1-2-3-5-10-20(28)15-16-22(17-27,18-8-6-4-7-9-18)31(29,30)21-13-11-19(12-14-21)23(24,25)26/h4,6-9,11-14H,2-3,5,10,15-16H2,1H3/t22-/m1/s1 |
| InChIKey | TZJJHOLRBJJZHN-JOCHJYFZSA-N |
| XLogP | 5.83 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|