C31H32NOPS — CID 25186191
(NE,S)-N-[[2-(2-diphenylphosphanyl-6-methylphenyl)-3-methylphenyl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 25186191) has the molecular formula C31H32NOPS and a molecular weight of 497.64 g/mol. Its IUPAC name is (NE,S)-N-[[2-(2-diphenylphosphanyl-6-methylphenyl)-3-methylphenyl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[[2-(2-diphenylphosphanyl-6-methylphenyl)-3-methylphenyl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 25186191 |
| Molecular Formula | C31H32NOPS |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | (NE,S)-N-[[2-(2-diphenylphosphanyl-6-methylphenyl)-3-methylphenyl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1cccc(/C=N/[S@@](=O)C(C)(C)C)c1-c1c(C)cccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32NOPS/c1-23-14-12-16-25(22-32-35(33)31(3,4)5)29(23)30-24(2)15-13-21-28(30)34(26-17-8-6-9-18-26)27-19-10-7-11-20-27/h6-22H,1-5H3/b32-22+/t35-/m0/s1 |
| InChIKey | MWMUQNYOSDWTHR-BUELQQIUSA-N |
| XLogP | 6.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|