C27H26F3NOS — CID 171932370
2-methyl-N-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide (PubChem CID 171932370) has the molecular formula C27H26F3NOS and a molecular weight of 469.57 g/mol. Its IUPAC name is 2-methyl-N-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 171932370 |
| Molecular Formula | C27H26F3NOS |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2-methyl-N-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide |
| SMILES | Cc1c(/C=C/c2cc(C=NS(=O)C(C)(C)C)ccc2C(F)(F)F)cccc1-c1ccccc1 |
| InChI | InChI=1S/C27H26F3NOS/c1-19-21(11-8-12-24(19)22-9-6-5-7-10-22)14-15-23-17-20(13-16-25(23)27(28,29)30)18-31-33(32)26(2,3)4/h5-18H,1-4H3/b15-14+,31-18? |
| InChIKey | GYNBWJPRKYPFEU-VSWQJDHGSA-N |
| XLogP | 7.73 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|