C24H25NO2 — CID 2518632
(4-tert-butyl-2-methylphenyl) 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate (PubChem CID 2518632) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (4-tert-butyl-2-methylphenyl) 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate.
| Compound Name | (4-tert-butyl-2-methylphenyl) 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 2518632 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (4-tert-butyl-2-methylphenyl) 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC(=O)c1c2c(nc3ccccc13)CCC2 |
| InChI | InChI=1S/C24H25NO2/c1-15-14-16(24(2,3)4)12-13-21(15)27-23(26)22-17-8-5-6-10-19(17)25-20-11-7-9-18(20)22/h5-6,8,10,12-14H,7,9,11H2,1-4H3 |
| InChIKey | MTYXVZZIMYXLEF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|