C17H30INO2 — CID 25187608
[(E,5S)-12-iodododec-11-en-5-yl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 25187608) has the molecular formula C17H30INO2 and a molecular weight of 407.34 g/mol. Its IUPAC name is [(E,5S)-12-iodododec-11-en-5-yl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(E,5S)-12-iodododec-11-en-5-yl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 25187608 |
| Molecular Formula | C17H30INO2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [(E,5S)-12-iodododec-11-en-5-yl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | CCCC[C@@H](CCCCC/C=C/I)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H30INO2/c1-2-3-10-15(11-7-5-4-6-8-13-18)21-17(20)16-12-9-14-19-16/h8,13,15-16,19H,2-7,9-12,14H2,1H3/b13-8+/t15-,16-/m0/s1 |
| InChIKey | NQKOCOAMGGQNIH-UKVVFRCISA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|