C19H22FNO4 — CID 25188145
tert-butyl N-[(E)-4-(4-fluorophenyl)-2-hydroxybut-3-enyl]-N-(furan-2-yl)carbamate (PubChem CID 25188145) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-(4-fluorophenyl)-2-hydroxybut-3-enyl]-N-(furan-2-yl)carbamate.
| Compound Name | tert-butyl N-[(E)-4-(4-fluorophenyl)-2-hydroxybut-3-enyl]-N-(furan-2-yl)carbamate |
|---|---|
| PubChem CID | 25188145 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | tert-butyl N-[(E)-4-(4-fluorophenyl)-2-hydroxybut-3-enyl]-N-(furan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(O)/C=C/c1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C19H22FNO4/c1-19(2,3)25-18(23)21(17-5-4-12-24-17)13-16(22)11-8-14-6-9-15(20)10-7-14/h4-12,16,22H,13H2,1-3H3/b11-8+ |
| InChIKey | DNAYSBIZCAVSJN-DHZHZOJOSA-N |
| XLogP | 4.23 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |