C21H23F2NO3 — CID 173332454
tert-butyl N-[(2S)-4-[3-fluoro-5-(4-fluorophenyl)phenyl]but-3-en-2-yl]-N-hydroxycarbamate (PubChem CID 173332454) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-[3-fluoro-5-(4-fluorophenyl)phenyl]but-3-en-2-yl]-N-hydroxycarbamate.
| Compound Name | tert-butyl N-[(2S)-4-[3-fluoro-5-(4-fluorophenyl)phenyl]but-3-en-2-yl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 173332454 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | tert-butyl N-[(2S)-4-[3-fluoro-5-(4-fluorophenyl)phenyl]but-3-en-2-yl]-N-hydroxycarbamate |
| SMILES | C[C@@H](C=Cc1cc(F)cc(-c2ccc(F)cc2)c1)N(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H23F2NO3/c1-14(24(26)20(25)27-21(2,3)4)5-6-15-11-17(13-19(23)12-15)16-7-9-18(22)10-8-16/h5-14,26H,1-4H3/t14-/m0/s1 |
| InChIKey | QQNUBBIVWVFARP-AWEZNQCLSA-N |
| XLogP | 5.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|