C29H30FN3O3 — CID 122439265
tert-butyl 2-[4-[4-[(E)-2-(3-fluoro-5-pyridin-4-ylphenyl)ethenyl]phenyl]piperazin-1-yl]-2-oxoacetate (PubChem CID 122439265) has the molecular formula C29H30FN3O3 and a molecular weight of 487.58 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-[(E)-2-(3-fluoro-5-pyridin-4-ylphenyl)ethenyl]phenyl]piperazin-1-yl]-2-oxoacetate.
| Compound Name | tert-butyl 2-[4-[4-[(E)-2-(3-fluoro-5-pyridin-4-ylphenyl)ethenyl]phenyl]piperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 122439265 |
| Molecular Formula | C29H30FN3O3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | tert-butyl 2-[4-[4-[(E)-2-(3-fluoro-5-pyridin-4-ylphenyl)ethenyl]phenyl]piperazin-1-yl]-2-oxoacetate |
| SMILES | CC(C)(C)OC(=O)C(=O)N1CCN(c2ccc(/C=C/c3cc(F)cc(-c4ccncc4)c3)cc2)CC1 |
| InChI | InChI=1S/C29H30FN3O3/c1-29(2,3)36-28(35)27(34)33-16-14-32(15-17-33)26-8-6-21(7-9-26)4-5-22-18-24(20-25(30)19-22)23-10-12-31-13-11-23/h4-13,18-20H,14-17H2,1-3H3/b5-4+ |
| InChIKey | JPMYEIHUHIFBBL-SNAWJCMRSA-N |
| XLogP | 5.05 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|