C28H31FN4O3 — CID 174795113
ethyl 2-[[4-[4-[2-(3-fluoro-5-pyridin-4-ylphenyl)ethyl]phenyl]piperazin-1-yl]-formylamino]acetate (PubChem CID 174795113) has the molecular formula C28H31FN4O3 and a molecular weight of 490.58 g/mol. Its IUPAC name is ethyl 2-[[4-[4-[2-(3-fluoro-5-pyridin-4-ylphenyl)ethyl]phenyl]piperazin-1-yl]-formylamino]acetate.
| Compound Name | ethyl 2-[[4-[4-[2-(3-fluoro-5-pyridin-4-ylphenyl)ethyl]phenyl]piperazin-1-yl]-formylamino]acetate |
|---|---|
| PubChem CID | 174795113 |
| Molecular Formula | C28H31FN4O3 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethyl 2-[[4-[4-[2-(3-fluoro-5-pyridin-4-ylphenyl)ethyl]phenyl]piperazin-1-yl]-formylamino]acetate |
| SMILES | CCOC(=O)CN(C=O)N1CCN(c2ccc(CCc3cc(F)cc(-c4ccncc4)c3)cc2)CC1 |
| InChI | InChI=1S/C28H31FN4O3/c1-2-36-28(35)20-33(21-34)32-15-13-31(14-16-32)27-7-5-22(6-8-27)3-4-23-17-25(19-26(29)18-23)24-9-11-30-12-10-24/h5-12,17-19,21H,2-4,13-16,20H2,1H3 |
| InChIKey | CCIKBJBKFHXQJD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|