C23H28FN3O3 — CID 49435772
ethyl 2-[(4-fluorophenyl)methyl-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]acetate (PubChem CID 49435772) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is ethyl 2-[(4-fluorophenyl)methyl-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]acetate.
| Compound Name | ethyl 2-[(4-fluorophenyl)methyl-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]acetate |
|---|---|
| PubChem CID | 49435772 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | ethyl 2-[(4-fluorophenyl)methyl-[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CC(=O)Nc1ccc(N2CCCC2)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FN3O3/c1-2-30-23(29)17-26(15-18-5-7-19(24)8-6-18)16-22(28)25-20-9-11-21(12-10-20)27-13-3-4-14-27/h5-12H,2-4,13-17H2,1H3,(H,25,28) |
| InChIKey | ACGODTXKWCGRKY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|