C22H25FN2O4 — CID 56526071
ethyl 2-[[3-(4-acetylanilino)-3-oxopropyl]-[(4-fluorophenyl)methyl]amino]acetate (PubChem CID 56526071) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is ethyl 2-[[3-(4-acetylanilino)-3-oxopropyl]-[(4-fluorophenyl)methyl]amino]acetate.
| Compound Name | ethyl 2-[[3-(4-acetylanilino)-3-oxopropyl]-[(4-fluorophenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 56526071 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 2-[[3-(4-acetylanilino)-3-oxopropyl]-[(4-fluorophenyl)methyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCC(=O)Nc1ccc(C(C)=O)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN2O4/c1-3-29-22(28)15-25(14-17-4-8-19(23)9-5-17)13-12-21(27)24-20-10-6-18(7-11-20)16(2)26/h4-11H,3,12-15H2,1-2H3,(H,24,27) |
| InChIKey | LLLADNMNVMGXFE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |