C31H28ClFN2O3 — CID 127026568
ethyl 4-[3-[4-chloro-N-[(4-fluorophenyl)methyl]-3-phenylanilino]propanoylamino]benzoate (PubChem CID 127026568) has the molecular formula C31H28ClFN2O3 and a molecular weight of 531.03 g/mol. Its IUPAC name is ethyl 4-[3-[4-chloro-N-[(4-fluorophenyl)methyl]-3-phenylanilino]propanoylamino]benzoate.
| Compound Name | ethyl 4-[3-[4-chloro-N-[(4-fluorophenyl)methyl]-3-phenylanilino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 127026568 |
| Molecular Formula | C31H28ClFN2O3 |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | ethyl 4-[3-[4-chloro-N-[(4-fluorophenyl)methyl]-3-phenylanilino]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCN(Cc2ccc(F)cc2)c2ccc(Cl)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H28ClFN2O3/c1-2-38-31(37)24-10-14-26(15-11-24)34-30(36)18-19-35(21-22-8-12-25(33)13-9-22)27-16-17-29(32)28(20-27)23-6-4-3-5-7-23/h3-17,20H,2,18-19,21H2,1H3,(H,34,36) |
| InChIKey | WANYJGKAMOCRCT-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |