C25H22FN3O3 — CID 154195180
2-[4-[4-[2-(3-fluoro-5-pyridin-4-ylphenyl)ethenyl]phenyl]piperazin-1-yl]-2-oxoacetic acid (PubChem CID 154195180) has the molecular formula C25H22FN3O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-[4-[4-[2-(3-fluoro-5-pyridin-4-ylphenyl)ethenyl]phenyl]piperazin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[4-[4-[2-(3-fluoro-5-pyridin-4-ylphenyl)ethenyl]phenyl]piperazin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 154195180 |
| Molecular Formula | C25H22FN3O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-[4-[4-[2-(3-fluoro-5-pyridin-4-ylphenyl)ethenyl]phenyl]piperazin-1-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)N1CCN(c2ccc(C=Cc3cc(F)cc(-c4ccncc4)c3)cc2)CC1 |
| InChI | InChI=1S/C25H22FN3O3/c26-22-16-19(15-21(17-22)20-7-9-27-10-8-20)2-1-18-3-5-23(6-4-18)28-11-13-29(14-12-28)24(30)25(31)32/h1-10,15-17H,11-14H2,(H,31,32) |
| InChIKey | GXDMECNSLAQEQP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|