C21H24N2O4 — CID 102439230
tert-butyl N-[2-(1-acetylindol-3-yl)ethyl]-N-(furan-2-yl)carbamate (PubChem CID 102439230) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is tert-butyl N-[2-(1-acetylindol-3-yl)ethyl]-N-(furan-2-yl)carbamate.
| Compound Name | tert-butyl N-[2-(1-acetylindol-3-yl)ethyl]-N-(furan-2-yl)carbamate |
|---|---|
| PubChem CID | 102439230 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | tert-butyl N-[2-(1-acetylindol-3-yl)ethyl]-N-(furan-2-yl)carbamate |
| SMILES | CC(=O)n1cc(CCN(C(=O)OC(C)(C)C)c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C21H24N2O4/c1-15(24)23-14-16(17-8-5-6-9-18(17)23)11-12-22(19-10-7-13-26-19)20(25)27-21(2,3)4/h5-10,13-14H,11-12H2,1-4H3 |
| InChIKey | YHPOCFKMYSJNLZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |