C13H15NO3 — CID 25189016
(2R,4aS,8aS)-2-phenyl-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridin-6-one (PubChem CID 25189016) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (2R,4aS,8aS)-2-phenyl-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridin-6-one.
| Compound Name | (2R,4aS,8aS)-2-phenyl-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 25189016 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2R,4aS,8aS)-2-phenyl-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridin-6-one |
| SMILES | O=C1CC[C@@H]2O[C@H](c3ccccc3)OC[C@@H]2N1 |
| InChI | InChI=1S/C13H15NO3/c15-12-7-6-11-10(14-12)8-16-13(17-11)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2,(H,14,15)/t10-,11-,13+/m0/s1 |
| InChIKey | LDKJJEPRRMGXOY-GMXVVIOVSA-N |
| XLogP | 1.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |