About 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide
4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide (PubChem CID 25189920) has the molecular formula C20H13FN2O3
and a molecular weight of 348.33 g/mol. Its IUPAC name is 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide |
| PubChem CID | 25189920 |
| Molecular Formula | C20H13FN2O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(C2=Nc3ccccc3Oc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C20H13FN2O3/c21-15-11-12(20(24)23-25)9-10-13(15)19-14-5-1-3-7-17(14)26-18-8-4-2-6-16(18)22-19/h1-11,25H,(H,23,24) |
| InChIKey | BFMWIFSWFYYOBS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide?
The IUPAC name of 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide (CID 25189920) is 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide.
What is the SMILES notation for 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide?
The canonical SMILES for 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide is O=C(NO)c1ccc(C2=Nc3ccccc3Oc3ccccc32)c(F)c1.
What is the InChIKey of 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide?
The InChIKey is BFMWIFSWFYYOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13FN2O3/c21-15-11-12(20(24)23-25)9-10-13(15)19-14-5-1-3-7-17(14)26-18-8-4-2-6-16(18)22-19/h1-11,25H,(H,23,24).
What are the key properties of 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide?
4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide has a molecular weight of 348.33 g/mol, XLogP of 4.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzo[b][1,4]benzoxazepin-6-yl-3-fluoro-N-hydroxybenzamide is sourced from PubChem (CID 25189920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).