C30H28N2O8 — CID 25190329
3-O-ethyl 5-O-[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 25190329) has the molecular formula C30H28N2O8 and a molecular weight of 544.56 g/mol. Its IUPAC name is 3-O-ethyl 5-O-[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 25190329 |
| Molecular Formula | C30H28N2O8 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 3-O-ethyl 5-O-[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC(=O)c2ccc3cc(OC)ccc3c2)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H28N2O8/c1-5-39-29(34)26-17(2)31-18(3)27(28(26)22-7-6-8-23(14-22)32(36)37)30(35)40-16-25(33)21-10-9-20-15-24(38-4)12-11-19(20)13-21/h6-15,28,31H,5,16H2,1-4H3/t28-/m0/s1 |
| InChIKey | HFTVTGUUQUQJOU-NDEPHWFRSA-N |
| XLogP | 4.98 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|