C15H28O3Si — CID 25191801
ethoxy-dimethyl-[(1E,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]silane (PubChem CID 25191801) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is ethoxy-dimethyl-[(1E,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]silane.
| Compound Name | ethoxy-dimethyl-[(1E,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 25191801 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | ethoxy-dimethyl-[(1E,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]silane |
| SMILES | CCO[Si](C)(C)/C=C/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C15H28O3Si/c1-5-18-19(3,4)13-10-14(2)9-12-17-15-8-6-7-11-16-15/h9-10,13,15H,5-8,11-12H2,1-4H3/b13-10+,14-9+ |
| InChIKey | CCHQTEHTIMLMBM-JUCMHCFKSA-N |
| XLogP | 3.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|