C10H11N3OS — CID 25196159
3-ethylsulfanyl-4-phenyl-1H-1,2,4-triazol-5-one (PubChem CID 25196159) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-ethylsulfanyl-4-phenyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-ethylsulfanyl-4-phenyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 25196159 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3-ethylsulfanyl-4-phenyl-1H-1,2,4-triazol-5-one |
| SMILES | CCSc1n[nH]c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C10H11N3OS/c1-2-15-10-12-11-9(14)13(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,11,14) |
| InChIKey | NKJSLXHLQXUGOA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |