C11H13N3OS — CID 2743358
4-phenyl-3-propan-2-ylsulfanyl-1H-1,2,4-triazol-5-one (PubChem CID 2743358) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-phenyl-3-propan-2-ylsulfanyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-phenyl-3-propan-2-ylsulfanyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 2743358 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-phenyl-3-propan-2-ylsulfanyl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)Sc1n[nH]c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C11H13N3OS/c1-8(2)16-11-13-12-10(15)14(11)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,12,15) |
| InChIKey | KGJSMQVRYJQJOD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |