C19H17ClN4O — CID 25197965
4-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-(4-methoxyphenyl)-2,5-dihydropyrrole-3-carbonitrile (PubChem CID 25197965) has the molecular formula C19H17ClN4O and a molecular weight of 352.83 g/mol. Its IUPAC name is 4-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-(4-methoxyphenyl)-2,5-dihydropyrrole-3-carbonitrile.
| Compound Name | 4-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-(4-methoxyphenyl)-2,5-dihydropyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 25197965 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-(4-methoxyphenyl)-2,5-dihydropyrrole-3-carbonitrile |
| SMILES | COc1ccc(N2CC(C#N)=C(N/N=C/c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C19H17ClN4O/c1-25-18-8-6-17(7-9-18)24-12-15(10-21)19(13-24)23-22-11-14-2-4-16(20)5-3-14/h2-9,11,23H,12-13H2,1H3/b22-11+ |
| InChIKey | OWHXJMWIKMGSOS-SSDVNMTOSA-N |
| XLogP | 3.57 |
| TPSA | 60.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|