C20H12Cl4N4O3 — CID 25198120
1-(4-methoxyphenyl)-4-[(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)amino]-2,5-dihydropyrrole-3-carbonitrile (PubChem CID 25198120) has the molecular formula C20H12Cl4N4O3 and a molecular weight of 498.15 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)amino]-2,5-dihydropyrrole-3-carbonitrile.
| Compound Name | 1-(4-methoxyphenyl)-4-[(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)amino]-2,5-dihydropyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 25198120 |
| Molecular Formula | C20H12Cl4N4O3 |
| Molecular Weight | 498.15 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)amino]-2,5-dihydropyrrole-3-carbonitrile |
| SMILES | COc1ccc(N2CC(C#N)=C(NN3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)C2)cc1 |
| InChI | InChI=1S/C20H12Cl4N4O3/c1-31-11-4-2-10(3-5-11)27-7-9(6-25)12(8-27)26-28-19(29)13-14(20(28)30)16(22)18(24)17(23)15(13)21/h2-5,26H,7-8H2,1H3 |
| InChIKey | RAROVJAVIBMCMC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.15 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|