C8H16N4 — CID 25198137
(2S,3S)-3-azido-2-methyl-1-propan-2-ylpyrrolidine (PubChem CID 25198137) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is (2S,3S)-3-azido-2-methyl-1-propan-2-ylpyrrolidine.
| Compound Name | (2S,3S)-3-azido-2-methyl-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 25198137 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | (2S,3S)-3-azido-2-methyl-1-propan-2-ylpyrrolidine |
| SMILES | CC(C)N1CC[C@H](N=[N+]=[N-])[C@@H]1C |
| InChI | InChI=1S/C8H16N4/c1-6(2)12-5-4-8(7(12)3)10-11-9/h6-8H,4-5H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | VBGFLILYIHLNSY-YUMQZZPRSA-N |
| XLogP | 2.17 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|