C24H30ClN5O3S — CID 25199176
5-[(4-chlorophenyl)sulfonylamino]-N-[2-(hexylamino)ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 25199176) has the molecular formula C24H30ClN5O3S and a molecular weight of 504.06 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)sulfonylamino]-N-[2-(hexylamino)ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-[(4-chlorophenyl)sulfonylamino]-N-[2-(hexylamino)ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25199176 |
| Molecular Formula | C24H30ClN5O3S |
| Molecular Weight | 504.06 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 5-[(4-chlorophenyl)sulfonylamino]-N-[2-(hexylamino)ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | CCCCCCNCCNC(=O)c1cnn(-c2ccccc2)c1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H30ClN5O3S/c1-2-3-4-8-15-26-16-17-27-24(31)22-18-28-30(20-9-6-5-7-10-20)23(22)29-34(32,33)21-13-11-19(25)12-14-21/h5-7,9-14,18,26,29H,2-4,8,15-17H2,1H3,(H,27,31) |
| InChIKey | HYLHJGBEPNPARE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.06 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|